C18H18N2O — CID 40541008
(3S)-3-(1-methoxyethenyl)-2,5-diphenyl-3,4-dihydropyrazole (PubChem CID 40541008) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is (3S)-3-(1-methoxyethenyl)-2,5-diphenyl-3,4-dihydropyrazole.
| Compound Name | (3S)-3-(1-methoxyethenyl)-2,5-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 40541008 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3S)-3-(1-methoxyethenyl)-2,5-diphenyl-3,4-dihydropyrazole |
| SMILES | C=C(OC)[C@@H]1CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c1-14(21-2)18-13-17(15-9-5-3-6-10-15)19-20(18)16-11-7-4-8-12-16/h3-12,18H,1,13H2,2H3/t18-/m0/s1 |
| InChIKey | GSLVCKBIVPUBMK-SFHVURJKSA-N |
| XLogP | 3.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|