methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate

C18H18N2O2 — CID 132918901

IUPACmethyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate
SMILESCOC(=O)C1CCC(c2ccccc2)=NN1c1ccccc1
InChIInChI=1S/C18H18N2O2/c1-22-18(21)17-13-12-16(14-8-4-2-5-9-14)19-20(17)15-10-6-3-7-11-15/h2-11,17H,12-13H2,1H3
InChIKeyAGXVXFXWNWHOPZ-UHFFFAOYSA-N
MW294.35 g/mol
LogP3.23
Rot. Bonds3

About methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate

methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate (PubChem CID 132918901) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate.

Molecular Properties

Compound Namemethyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate
PubChem CID132918901
Molecular FormulaC18H18N2O2
Molecular Weight294.35 g/mol
Exact Mass294.14
IUPAC Namemethyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate
SMILESCOC(=O)C1CCC(c2ccccc2)=NN1c1ccccc1
InChIInChI=1S/C18H18N2O2/c1-22-18(21)17-13-12-16(14-8-4-2-5-9-14)19-20(17)15-10-6-3-7-11-15/h2-11,17H,12-13H2,1H3
InChIKeyAGXVXFXWNWHOPZ-UHFFFAOYSA-N
XLogP3.23
TPSA41.90 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.35
LogP ≤ 53.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate?
The IUPAC name of methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate (CID 132918901) is methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate.
What is the SMILES notation for methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate?
The canonical SMILES for methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate is COC(=O)C1CCC(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate?
The InChIKey is AGXVXFXWNWHOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-22-18(21)17-13-12-16(14-8-4-2-5-9-14)19-20(17)15-10-6-3-7-11-15/h2-11,17H,12-13H2,1H3.
What are the key properties of methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate?
methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate has a molecular weight of 294.35 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-diphenyl-4,5-dihydro-3H-pyridazine-3-carboxylate is sourced from PubChem (CID 132918901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).