C15H16N4O5 — CID 50927850
dimethyl 1-(1-anilino-1-oxopropan-2-yl)triazole-4,5-dicarboxylate (PubChem CID 50927850) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is dimethyl 1-(1-anilino-1-oxopropan-2-yl)triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-(1-anilino-1-oxopropan-2-yl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 50927850 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | dimethyl 1-(1-anilino-1-oxopropan-2-yl)triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(C(C)C(=O)Nc2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C15H16N4O5/c1-9(13(20)16-10-7-5-4-6-8-10)19-12(15(22)24-3)11(17-18-19)14(21)23-2/h4-9H,1-3H3,(H,16,20) |
| InChIKey | DXKQXHVZNGCRJY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |