C20H18ClNO2 — CID 91088883
4-[(4-chlorophenoxy)methyl]-1-(3,4-dimethylphenyl)pyridin-2-one (PubChem CID 91088883) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-1-(3,4-dimethylphenyl)pyridin-2-one.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-1-(3,4-dimethylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 91088883 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-1-(3,4-dimethylphenyl)pyridin-2-one |
| SMILES | Cc1ccc(-n2ccc(COc3ccc(Cl)cc3)cc2=O)cc1C |
| InChI | InChI=1S/C20H18ClNO2/c1-14-3-6-18(11-15(14)2)22-10-9-16(12-20(22)23)13-24-19-7-4-17(21)5-8-19/h3-12H,13H2,1-2H3 |
| InChIKey | FVQOPMVSJQEIIP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |