C22H20ClNO5 — CID 70644356
4-[(4-chlorophenoxy)methyl]-1-[4-[(Z)-2,3-dihydroxyprop-2-enoxy]-3-methylphenyl]pyridin-2-one (PubChem CID 70644356) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]-1-[4-[(Z)-2,3-dihydroxyprop-2-enoxy]-3-methylphenyl]pyridin-2-one.
| Compound Name | 4-[(4-chlorophenoxy)methyl]-1-[4-[(Z)-2,3-dihydroxyprop-2-enoxy]-3-methylphenyl]pyridin-2-one |
|---|---|
| PubChem CID | 70644356 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]-1-[4-[(Z)-2,3-dihydroxyprop-2-enoxy]-3-methylphenyl]pyridin-2-one |
| SMILES | Cc1cc(-n2ccc(COc3ccc(Cl)cc3)cc2=O)ccc1OC/C(O)=C/O |
| InChI | InChI=1S/C22H20ClNO5/c1-15-10-18(4-7-21(15)29-14-19(26)12-25)24-9-8-16(11-22(24)27)13-28-20-5-2-17(23)3-6-20/h2-12,25-26H,13-14H2,1H3/b19-12- |
| InChIKey | MSLACRDJWQTFME-UNOMPAQXSA-N |
| XLogP | 4.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|