C25H23F2NO2 — CID 58580275
4-[2-(3,4-difluorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methylphenyl]pyridin-2-one (PubChem CID 58580275) has the molecular formula C25H23F2NO2 and a molecular weight of 407.46 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methylphenyl]pyridin-2-one.
| Compound Name | 4-[2-(3,4-difluorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methylphenyl]pyridin-2-one |
|---|---|
| PubChem CID | 58580275 |
| Molecular Formula | C25H23F2NO2 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methylphenyl]pyridin-2-one |
| SMILES | Cc1cc(-n2ccc(C#Cc3ccc(F)c(F)c3)cc2=O)ccc1OCC(C)(C)C |
| InChI | InChI=1S/C25H23F2NO2/c1-17-13-20(8-10-23(17)30-16-25(2,3)4)28-12-11-19(15-24(28)29)6-5-18-7-9-21(26)22(27)14-18/h7-15H,16H2,1-4H3 |
| InChIKey | XHSITCAJWZAWTJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|