C24H23ClN2O3 — CID 58579919
4-[2-(4-chlorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]pyrimidin-2-one (PubChem CID 58579919) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]pyrimidin-2-one.
| Compound Name | 4-[2-(4-chlorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 58579919 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethynyl]-1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]pyrimidin-2-one |
| SMILES | COc1cc(-n2ccc(C#Cc3ccc(Cl)cc3)nc2=O)ccc1OCC(C)(C)C |
| InChI | InChI=1S/C24H23ClN2O3/c1-24(2,3)16-30-21-12-11-20(15-22(21)29-4)27-14-13-19(26-23(27)28)10-7-17-5-8-18(25)9-6-17/h5-6,8-9,11-15H,16H2,1-4H3 |
| InChIKey | JJZKHBROUWGISP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|