C23H23IN2O4 — CID 89034043
1-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-4-[(E)-2-(4-iodophenyl)ethenyl]pyrimidin-2-one (PubChem CID 89034043) has the molecular formula C23H23IN2O4 and a molecular weight of 518.35 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-4-[(E)-2-(4-iodophenyl)ethenyl]pyrimidin-2-one.
| Compound Name | 1-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-4-[(E)-2-(4-iodophenyl)ethenyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 89034043 |
| Molecular Formula | C23H23IN2O4 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 1-[4-(2-hydroxy-2-methylpropoxy)-3-methoxyphenyl]-4-[(E)-2-(4-iodophenyl)ethenyl]pyrimidin-2-one |
| SMILES | COc1cc(-n2ccc(/C=C/c3ccc(I)cc3)nc2=O)ccc1OCC(C)(C)O |
| InChI | InChI=1S/C23H23IN2O4/c1-23(2,28)15-30-20-11-10-19(14-21(20)29-3)26-13-12-18(25-22(26)27)9-6-16-4-7-17(24)8-5-16/h4-14,28H,15H2,1-3H3/b9-6+ |
| InChIKey | KSMKVQUWIONBEQ-RMKNXTFCSA-N |
| XLogP | 4.17 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|