C23H22ClN3O2 — CID 123490591
1-[4-amino-3-(N-cyclopropyl-C-methylcarbonimidoyl)phenyl]-4-[(4-chlorophenyl)methoxy]pyridin-2-one (PubChem CID 123490591) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 1-[4-amino-3-(N-cyclopropyl-C-methylcarbonimidoyl)phenyl]-4-[(4-chlorophenyl)methoxy]pyridin-2-one.
| Compound Name | 1-[4-amino-3-(N-cyclopropyl-C-methylcarbonimidoyl)phenyl]-4-[(4-chlorophenyl)methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 123490591 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-[4-amino-3-(N-cyclopropyl-C-methylcarbonimidoyl)phenyl]-4-[(4-chlorophenyl)methoxy]pyridin-2-one |
| SMILES | C/C(=N\C1CC1)c1cc(-n2ccc(OCc3ccc(Cl)cc3)cc2=O)ccc1N |
| InChI | InChI=1S/C23H22ClN3O2/c1-15(26-18-6-7-18)21-12-19(8-9-22(21)25)27-11-10-20(13-23(27)28)29-14-16-2-4-17(24)5-3-16/h2-5,8-13,18H,6-7,14,25H2,1H3/b26-15+ |
| InChIKey | YYPNYYOFTKKTTL-CVKSISIWSA-N |
| XLogP | 4.62 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|