C24H25N3O3 — CID 24780737
1-[4-(2-oxo-4-phenylmethoxy-1-pyridinyl)phenyl]piperidine-4-carboxamide (PubChem CID 24780737) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[4-(2-oxo-4-phenylmethoxy-1-pyridinyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2-oxo-4-phenylmethoxy-1-pyridinyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24780737 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[4-(2-oxo-4-phenylmethoxy-1-pyridinyl)phenyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(-n3ccc(OCc4ccccc4)cc3=O)cc2)CC1 |
| InChI | InChI=1S/C24H25N3O3/c25-24(29)19-10-13-26(14-11-19)20-6-8-21(9-7-20)27-15-12-22(16-23(27)28)30-17-18-4-2-1-3-5-18/h1-9,12,15-16,19H,10-11,13-14,17H2,(H2,25,29) |
| InChIKey | CINOOKSRGUJTJJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|