C27H31N3O2 — CID 24951464
1-[4-(2,9-diazaspiro[5.5]undecan-9-yl)phenyl]-4-phenylmethoxypyridin-2-one (PubChem CID 24951464) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[4-(2,9-diazaspiro[5.5]undecan-9-yl)phenyl]-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-[4-(2,9-diazaspiro[5.5]undecan-9-yl)phenyl]-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 24951464 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[4-(2,9-diazaspiro[5.5]undecan-9-yl)phenyl]-4-phenylmethoxypyridin-2-one |
| SMILES | O=c1cc(OCc2ccccc2)ccn1-c1ccc(N2CCC3(CCCNC3)CC2)cc1 |
| InChI | InChI=1S/C27H31N3O2/c31-26-19-25(32-20-22-5-2-1-3-6-22)11-16-30(26)24-9-7-23(8-10-24)29-17-13-27(14-18-29)12-4-15-28-21-27/h1-3,5-11,16,19,28H,4,12-15,17-18,20-21H2 |
| InChIKey | DIQLOTVRXVICNA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|