C15H15ClO — CID 64764553
4-[(3-chlorophenoxy)methyl]-1,2-dimethylbenzene (PubChem CID 64764553) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-1,2-dimethylbenzene.
| Compound Name | 4-[(3-chlorophenoxy)methyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 64764553 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-[(3-chlorophenoxy)methyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(COc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C15H15ClO/c1-11-6-7-13(8-12(11)2)10-17-15-5-3-4-14(16)9-15/h3-9H,10H2,1-2H3 |
| InChIKey | UMSWFTYKGPQRQJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |