C14H13ClO — CID 70594513
4-(3-chlorophenoxy)-1,2-dimethylbenzene (PubChem CID 70594513) has the molecular formula C14H13ClO and a molecular weight of 232.71 g/mol. Its IUPAC name is 4-(3-chlorophenoxy)-1,2-dimethylbenzene.
| Compound Name | 4-(3-chlorophenoxy)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 70594513 |
| Molecular Formula | C14H13ClO |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(3-chlorophenoxy)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(Oc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C14H13ClO/c1-10-6-7-14(8-11(10)2)16-13-5-3-4-12(15)9-13/h3-9H,1-2H3 |
| InChIKey | XVFBSGUNWSQQDR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |