C15H14Cl2O — CID 114846964
4-chloro-1-(chloromethyl)-2-(3,4-dimethylphenoxy)benzene (PubChem CID 114846964) has the molecular formula C15H14Cl2O and a molecular weight of 281.18 g/mol. Its IUPAC name is 4-chloro-1-(chloromethyl)-2-(3,4-dimethylphenoxy)benzene.
| Compound Name | 4-chloro-1-(chloromethyl)-2-(3,4-dimethylphenoxy)benzene |
|---|---|
| PubChem CID | 114846964 |
| Molecular Formula | C15H14Cl2O |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-chloro-1-(chloromethyl)-2-(3,4-dimethylphenoxy)benzene |
| SMILES | Cc1ccc(Oc2cc(Cl)ccc2CCl)cc1C |
| InChI | InChI=1S/C15H14Cl2O/c1-10-3-6-14(7-11(10)2)18-15-8-13(17)5-4-12(15)9-16/h3-8H,9H2,1-2H3 |
| InChIKey | GMAXDEIRAAXRRZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|