C14H13BrO — CID 169336658
4-(4-bromophenoxy)-1,2-dimethylbenzene (PubChem CID 169336658) has the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-1,2-dimethylbenzene.
| Compound Name | 4-(4-bromophenoxy)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 169336658 |
| Molecular Formula | C14H13BrO |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 4-(4-bromophenoxy)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(Oc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C14H13BrO/c1-10-3-6-14(9-11(10)2)16-13-7-4-12(15)5-8-13/h3-9H,1-2H3 |
| InChIKey | FTHGSQXKYLFFQB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |