C24H15Br3O3 — CID 102025054
1,3,5-tris(4-bromophenoxy)benzene (PubChem CID 102025054) has the molecular formula C24H15Br3O3 and a molecular weight of 591.09 g/mol. Its IUPAC name is 1,3,5-tris(4-bromophenoxy)benzene.
| Compound Name | 1,3,5-tris(4-bromophenoxy)benzene |
|---|---|
| PubChem CID | 102025054 |
| Molecular Formula | C24H15Br3O3 |
| Molecular Weight | 591.09 g/mol |
| Exact Mass | 587.86 |
| IUPAC Name | 1,3,5-tris(4-bromophenoxy)benzene |
| SMILES | Brc1ccc(Oc2cc(Oc3ccc(Br)cc3)cc(Oc3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C24H15Br3O3/c25-16-1-7-19(8-2-16)28-22-13-23(29-20-9-3-17(26)4-10-20)15-24(14-22)30-21-11-5-18(27)6-12-21/h1-15H |
| InChIKey | XTGUKVQAALXTLO-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.09 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |