C24H18O3S3 — CID 153347522
4-[3,5-bis(4-sulfanylphenoxy)phenoxy]benzenethiol (PubChem CID 153347522) has the molecular formula C24H18O3S3 and a molecular weight of 450.61 g/mol. Its IUPAC name is 4-[3,5-bis(4-sulfanylphenoxy)phenoxy]benzenethiol.
| Compound Name | 4-[3,5-bis(4-sulfanylphenoxy)phenoxy]benzenethiol |
|---|---|
| PubChem CID | 153347522 |
| Molecular Formula | C24H18O3S3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 4-[3,5-bis(4-sulfanylphenoxy)phenoxy]benzenethiol |
| SMILES | Sc1ccc(Oc2cc(Oc3ccc(S)cc3)cc(Oc3ccc(S)cc3)c2)cc1 |
| InChI | InChI=1S/C24H18O3S3/c28-22-7-1-16(2-8-22)25-19-13-20(26-17-3-9-23(29)10-4-17)15-21(14-19)27-18-5-11-24(30)12-6-18/h1-15,28-30H |
| InChIKey | ATGQBNBTDUNOGQ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|