C16H19BO — CID 58429995
[4-(3,4-dimethylphenoxy)phenyl]-dimethylborane (PubChem CID 58429995) has the molecular formula C16H19BO and a molecular weight of 238.14 g/mol. Its IUPAC name is [4-(3,4-dimethylphenoxy)phenyl]-dimethylborane.
| Compound Name | [4-(3,4-dimethylphenoxy)phenyl]-dimethylborane |
|---|---|
| PubChem CID | 58429995 |
| Molecular Formula | C16H19BO |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | [4-(3,4-dimethylphenoxy)phenyl]-dimethylborane |
| SMILES | CB(C)c1ccc(Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C16H19BO/c1-12-5-8-16(11-13(12)2)18-15-9-6-14(7-10-15)17(3)4/h5-11H,1-4H3 |
| InChIKey | WFDMMSXMRJZJCD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|