C22H20O — CID 145094302
1,2-dimethyl-4-[4-(1-phenylethenyl)phenoxy]benzene (PubChem CID 145094302) has the molecular formula C22H20O and a molecular weight of 300.40 g/mol. Its IUPAC name is 1,2-dimethyl-4-[4-(1-phenylethenyl)phenoxy]benzene.
| Compound Name | 1,2-dimethyl-4-[4-(1-phenylethenyl)phenoxy]benzene |
|---|---|
| PubChem CID | 145094302 |
| Molecular Formula | C22H20O |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1,2-dimethyl-4-[4-(1-phenylethenyl)phenoxy]benzene |
| SMILES | C=C(c1ccccc1)c1ccc(Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C22H20O/c1-16-9-12-22(15-17(16)2)23-21-13-10-20(11-14-21)18(3)19-7-5-4-6-8-19/h4-15H,3H2,1-2H3 |
| InChIKey | KLNBNXGUYATVMS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |