C15H12BrNO — CID 114902365
4-bromo-2-(3,4-dimethylphenoxy)benzonitrile (PubChem CID 114902365) has the molecular formula C15H12BrNO and a molecular weight of 302.17 g/mol. Its IUPAC name is 4-bromo-2-(3,4-dimethylphenoxy)benzonitrile.
| Compound Name | 4-bromo-2-(3,4-dimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 114902365 |
| Molecular Formula | C15H12BrNO |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-bromo-2-(3,4-dimethylphenoxy)benzonitrile |
| SMILES | Cc1ccc(Oc2cc(Br)ccc2C#N)cc1C |
| InChI | InChI=1S/C15H12BrNO/c1-10-3-6-14(7-11(10)2)18-15-8-13(16)5-4-12(15)9-17/h3-8H,1-2H3 |
| InChIKey | OBLVQSGMBQNWAK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |