C17H16BrNO2 — CID 20986331
5-bromo-2-[2-(3,4-dimethylphenoxy)ethoxy]benzonitrile (PubChem CID 20986331) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 5-bromo-2-[2-(3,4-dimethylphenoxy)ethoxy]benzonitrile.
| Compound Name | 5-bromo-2-[2-(3,4-dimethylphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 20986331 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 5-bromo-2-[2-(3,4-dimethylphenoxy)ethoxy]benzonitrile |
| SMILES | Cc1ccc(OCCOc2ccc(Br)cc2C#N)cc1C |
| InChI | InChI=1S/C17H16BrNO2/c1-12-3-5-16(9-13(12)2)20-7-8-21-17-6-4-15(18)10-14(17)11-19/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | NHVGFGOEFQVKQO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|