C17H14BrNO2 — CID 83136320
5-bromo-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]benzonitrile (PubChem CID 83136320) has the molecular formula C17H14BrNO2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-bromo-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]benzonitrile.
| Compound Name | 5-bromo-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 83136320 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-bromo-2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]benzonitrile |
| SMILES | Cc1ccc(C(=O)COc2ccc(Br)cc2C#N)cc1C |
| InChI | InChI=1S/C17H14BrNO2/c1-11-3-4-13(7-12(11)2)16(20)10-21-17-6-5-15(18)8-14(17)9-19/h3-8H,10H2,1-2H3 |
| InChIKey | NKMYBXUJYFCWGQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |