C15H16BrNO — CID 114889855
[5-bromo-2-(3,4-dimethylphenoxy)phenyl]methanamine (PubChem CID 114889855) has the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. Its IUPAC name is [5-bromo-2-(3,4-dimethylphenoxy)phenyl]methanamine.
| Compound Name | [5-bromo-2-(3,4-dimethylphenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 114889855 |
| Molecular Formula | C15H16BrNO |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | [5-bromo-2-(3,4-dimethylphenoxy)phenyl]methanamine |
| SMILES | Cc1ccc(Oc2ccc(Br)cc2CN)cc1C |
| InChI | InChI=1S/C15H16BrNO/c1-10-3-5-14(7-11(10)2)18-15-6-4-13(16)8-12(15)9-17/h3-8H,9,17H2,1-2H3 |
| InChIKey | NFHYELICLYVREI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |