C14H16N2O — CID 59112975
[3-(3,4-dimethylphenoxy)-4-pyridinyl]methanamine (PubChem CID 59112975) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is [3-(3,4-dimethylphenoxy)-4-pyridinyl]methanamine.
| Compound Name | [3-(3,4-dimethylphenoxy)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 59112975 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [3-(3,4-dimethylphenoxy)-4-pyridinyl]methanamine |
| SMILES | Cc1ccc(Oc2cnccc2CN)cc1C |
| InChI | InChI=1S/C14H16N2O/c1-10-3-4-13(7-11(10)2)17-14-9-16-6-5-12(14)8-15/h3-7,9H,8,15H2,1-2H3 |
| InChIKey | XVKCMLQATYBEBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |