C17H19ClO2 — CID 105081897
1-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propan-2-ol (PubChem CID 105081897) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 105081897 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propan-2-ol |
| SMILES | Cc1ccc(CC(O)COc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C17H19ClO2/c1-12-6-7-14(8-13(12)2)9-16(19)11-20-17-5-3-4-15(18)10-17/h3-8,10,16,19H,9,11H2,1-2H3 |
| InChIKey | SZLSOUMNNXUWMQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |