C15H15NO4 — CID 54724193
methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate (PubChem CID 54724193) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate.
| Compound Name | methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 54724193 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(-n2c(C)cc(O)cc2=O)c1 |
| InChI | InChI=1S/C15H15NO4/c1-9-4-5-11(15(19)20-3)7-13(9)16-10(2)6-12(17)8-14(16)18/h4-8,17H,1-3H3 |
| InChIKey | XJSKWXUZDHKHPR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |