C34H38N2O12 — CID 158581916
5-(1-hydroxy-3-oxobutylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione;methyl 3-amino-4-methylbenzoate;methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate (PubChem CID 158581916) has the molecular formula C34H38N2O12 and a molecular weight of 666.68 g/mol. Its IUPAC name is 5-(1-hydroxy-3-oxobutylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione;methyl 3-amino-4-methylbenzoate;methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate.
| Compound Name | 5-(1-hydroxy-3-oxobutylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione;methyl 3-amino-4-methylbenzoate;methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 158581916 |
| Molecular Formula | C34H38N2O12 |
| Molecular Weight | 666.68 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | 5-(1-hydroxy-3-oxobutylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione;methyl 3-amino-4-methylbenzoate;methyl 3-(4-hydroxy-2-methyl-6-oxo-1-pyridinyl)-4-methylbenzoate |
| SMILES | CC(=O)CC(O)=C1C(=O)OC(C)(C)OC1=O.COC(=O)c1ccc(C)c(-n2c(C)cc(O)cc2=O)c1.COC(=O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C15H15NO4.C10H12O6.C9H11NO2/c1-9-4-5-11(15(19)20-3)7-13(9)16-10(2)6-12(17)8-14(16)18;1-5(11)4-6(12)7-8(13)15-10(2,3)16-9(7)14;1-6-3-4-7(5-8(6)10)9(11)12-2/h4-8,17H,1-3H3;12H,4H2,1-3H3;3-5H,10H2,1-2H3 |
| InChIKey | HTIVLDBVOUHQPI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|