C24H28ClN3O6Si — CID 68734365
1-(4-chlorophenyl)-3-[[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]pyrazole-4-carboxylic acid (PubChem CID 68734365) has the molecular formula C24H28ClN3O6Si and a molecular weight of 518.04 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-(4-chlorophenyl)-3-[[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68734365 |
| Molecular Formula | C24H28ClN3O6Si |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]pyrazole-4-carboxylic acid |
| SMILES | COc1cc(NC(=O)c2nn(-c3ccc(Cl)cc3)cc2C(=O)O)ccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H28ClN3O6Si/c1-32-21-13-17(7-10-20(21)34-15-33-11-12-35(2,3)4)26-23(29)22-19(24(30)31)14-28(27-22)18-8-5-16(25)6-9-18/h5-10,13-14H,11-12,15H2,1-4H3,(H,26,29)(H,30,31) |
| InChIKey | ZJULOBYIRXDIIP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|