C21H21Cl2N3O4 — CID 58386139
4-(chloromethyl)-1-(4-chlorophenyl)-N-[4-(2-hydroxypropoxy)-3-methoxyphenyl]pyrazole-3-carboxamide (PubChem CID 58386139) has the molecular formula C21H21Cl2N3O4 and a molecular weight of 450.32 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(4-chlorophenyl)-N-[4-(2-hydroxypropoxy)-3-methoxyphenyl]pyrazole-3-carboxamide.
| Compound Name | 4-(chloromethyl)-1-(4-chlorophenyl)-N-[4-(2-hydroxypropoxy)-3-methoxyphenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58386139 |
| Molecular Formula | C21H21Cl2N3O4 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 4-(chloromethyl)-1-(4-chlorophenyl)-N-[4-(2-hydroxypropoxy)-3-methoxyphenyl]pyrazole-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2nn(-c3ccc(Cl)cc3)cc2CCl)ccc1OCC(C)O |
| InChI | InChI=1S/C21H21Cl2N3O4/c1-13(27)12-30-18-8-5-16(9-19(18)29-2)24-21(28)20-14(10-22)11-26(25-20)17-6-3-15(23)4-7-17/h3-9,11,13,27H,10,12H2,1-2H3,(H,24,28) |
| InChIKey | NBRSFFLSQNEZTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|