C19H27NO5Si — CID 58580238
4-(hydroxymethyl)-1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]pyridin-2-one (PubChem CID 58580238) has the molecular formula C19H27NO5Si and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]pyridin-2-one.
| Compound Name | 4-(hydroxymethyl)-1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 58580238 |
| Molecular Formula | C19H27NO5Si |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(hydroxymethyl)-1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]pyridin-2-one |
| SMILES | COc1cc(-n2ccc(CO)cc2=O)ccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H27NO5Si/c1-23-18-12-16(20-8-7-15(13-21)11-19(20)22)5-6-17(18)25-14-24-9-10-26(2,3)4/h5-8,11-12,21H,9-10,13-14H2,1-4H3 |
| InChIKey | ZREIGKMEKDVPLS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|