C24H33NO5Si — CID 160523814
1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-(4-methylphenoxy)pyrrolidin-2-one (PubChem CID 160523814) has the molecular formula C24H33NO5Si and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-(4-methylphenoxy)pyrrolidin-2-one.
| Compound Name | 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-(4-methylphenoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 160523814 |
| Molecular Formula | C24H33NO5Si |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-(4-methylphenoxy)pyrrolidin-2-one |
| SMILES | COc1cc(N2CCC(Oc3ccc(C)cc3)C2=O)ccc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C24H33NO5Si/c1-18-6-9-20(10-7-18)30-22-12-13-25(24(22)26)19-8-11-21(23(16-19)27-2)29-17-28-14-15-31(3,4)5/h6-11,16,22H,12-15,17H2,1-5H3 |
| InChIKey | QUQCGAHOLFLMMZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|