C22H26INO4 — CID 126651604
1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]-3-(4-iodophenoxy)pyrrolidin-2-one (PubChem CID 126651604) has the molecular formula C22H26INO4 and a molecular weight of 495.36 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]-3-(4-iodophenoxy)pyrrolidin-2-one.
| Compound Name | 1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]-3-(4-iodophenoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 126651604 |
| Molecular Formula | C22H26INO4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 1-[4-(2,2-dimethylpropoxy)-3-methoxyphenyl]-3-(4-iodophenoxy)pyrrolidin-2-one |
| SMILES | COc1cc(N2CCC(Oc3ccc(I)cc3)C2=O)ccc1OCC(C)(C)C |
| InChI | InChI=1S/C22H26INO4/c1-22(2,3)14-27-18-10-7-16(13-20(18)26-4)24-12-11-19(21(24)25)28-17-8-5-15(23)6-9-17/h5-10,13,19H,11-12,14H2,1-4H3 |
| InChIKey | ZCJLBLFVRSCFSJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|