C27H37NO3Si — CID 90001923
1-[4-[tert-butyl(dimethyl)silyl]oxy-3-ethylphenyl]-3-(4-cyclopropylphenoxy)pyrrolidin-2-one (PubChem CID 90001923) has the molecular formula C27H37NO3Si and a molecular weight of 451.68 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-ethylphenyl]-3-(4-cyclopropylphenoxy)pyrrolidin-2-one.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-ethylphenyl]-3-(4-cyclopropylphenoxy)pyrrolidin-2-one |
|---|---|
| PubChem CID | 90001923 |
| Molecular Formula | C27H37NO3Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxy-3-ethylphenyl]-3-(4-cyclopropylphenoxy)pyrrolidin-2-one |
| SMILES | CCc1cc(N2CCC(Oc3ccc(C4CC4)cc3)C2=O)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H37NO3Si/c1-7-19-18-22(12-15-24(19)31-32(5,6)27(2,3)4)28-17-16-25(26(28)29)30-23-13-10-21(11-14-23)20-8-9-20/h10-15,18,20,25H,7-9,16-17H2,1-6H3 |
| InChIKey | BBQPFSWMCBEJHP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|