C22H28FN3O3Si — CID 171799542
N-(4-fluoro-3-methoxyphenyl)-7-methyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide (PubChem CID 171799542) has the molecular formula C22H28FN3O3Si and a molecular weight of 429.57 g/mol. Its IUPAC name is N-(4-fluoro-3-methoxyphenyl)-7-methyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide.
| Compound Name | N-(4-fluoro-3-methoxyphenyl)-7-methyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 171799542 |
| Molecular Formula | C22H28FN3O3Si |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-(4-fluoro-3-methoxyphenyl)-7-methyl-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(C)c3ncn(COCC[Si](C)(C)C)c3c2)ccc1F |
| InChI | InChI=1S/C22H28FN3O3Si/c1-15-10-16(22(27)25-17-6-7-18(23)20(12-17)28-2)11-19-21(15)24-13-26(19)14-29-8-9-30(3,4)5/h6-7,10-13H,8-9,14H2,1-5H3,(H,25,27) |
| InChIKey | PANUNSRKLWXYOT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|