C9H18N2O2Si — CID 90030095
1-(2-trimethylsilylethoxymethyl)pyrazol-4-ol (PubChem CID 90030095) has the molecular formula C9H18N2O2Si and a molecular weight of 214.34 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)pyrazol-4-ol.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)pyrazol-4-ol |
|---|---|
| PubChem CID | 90030095 |
| Molecular Formula | C9H18N2O2Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)pyrazol-4-ol |
| SMILES | C[Si](C)(C)CCOCn1cc(O)cn1 |
| InChI | InChI=1S/C9H18N2O2Si/c1-14(2,3)5-4-13-8-11-7-9(12)6-10-11/h6-7,12H,4-5,8H2,1-3H3 |
| InChIKey | CJBBMOOSORHAGU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|