C9H19N3OSi — CID 162471260
trimethyl-[2-[(3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane (PubChem CID 162471260) has the molecular formula C9H19N3OSi and a molecular weight of 213.36 g/mol. Its IUPAC name is trimethyl-[2-[(3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 162471260 |
| Molecular Formula | C9H19N3OSi |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | trimethyl-[2-[(3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl]silane |
| SMILES | Cc1ncn(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C9H19N3OSi/c1-9-10-7-12(11-9)8-13-5-6-14(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | NKOHXQBGQYZUCB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|