C9H18BrN3OSi — CID 170992560
2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 170992560) has the molecular formula C9H18BrN3OSi and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 170992560 |
| Molecular Formula | C9H18BrN3OSi |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(5-bromo-3-methyl-1,2,4-triazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc(Br)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C9H18BrN3OSi/c1-8-11-9(10)13(12-8)7-14-5-6-15(2,3)4/h5-7H2,1-4H3 |
| InChIKey | RCLXUCDRVJTBQW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|