C12H18BrClN4OSi — CID 169206863
7-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 169206863) has the molecular formula C12H18BrClN4OSi and a molecular weight of 377.75 g/mol. Its IUPAC name is 7-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-3-amine.
| Compound Name | 7-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 169206863 |
| Molecular Formula | C12H18BrClN4OSi |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 7-bromo-5-chloro-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | C[Si](C)(C)CCOCn1nc2c(Br)cc(Cl)nc2c1N |
| InChI | InChI=1S/C12H18BrClN4OSi/c1-20(2,3)5-4-19-7-18-12(15)11-10(17-18)8(13)6-9(14)16-11/h6H,4-5,7,15H2,1-3H3 |
| InChIKey | LWGUFSFEMPQZAK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|