C16H24ClF2N5OSi — CID 171630055
4-[4-amino-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-chloro-2-(difluoromethyl)pyridin-3-amine (PubChem CID 171630055) has the molecular formula C16H24ClF2N5OSi and a molecular weight of 403.94 g/mol. Its IUPAC name is 4-[4-amino-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-chloro-2-(difluoromethyl)pyridin-3-amine.
| Compound Name | 4-[4-amino-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-chloro-2-(difluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 171630055 |
| Molecular Formula | C16H24ClF2N5OSi |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 4-[4-amino-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-6-chloro-2-(difluoromethyl)pyridin-3-amine |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(-c2cc(Cl)nc(C(F)F)c2N)c1N |
| InChI | InChI=1S/C16H24ClF2N5OSi/c1-9-12(20)15(24(23-9)8-25-5-6-26(2,3)4)10-7-11(17)22-14(13(10)21)16(18)19/h7,16H,5-6,8,20-21H2,1-4H3 |
| InChIKey | QHNIMPAPUDJQAE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|