C16H25Cl2N3OSi — CID 162354492
6-chloro-2-(3-chloropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 162354492) has the molecular formula C16H25Cl2N3OSi and a molecular weight of 374.39 g/mol. Its IUPAC name is 6-chloro-2-(3-chloropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-2-(3-chloropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 162354492 |
| Molecular Formula | C16H25Cl2N3OSi |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-chloro-2-(3-chloropropyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1c(CCCCl)cc2c(N)cc(Cl)nc21 |
| InChI | InChI=1S/C16H25Cl2N3OSi/c1-23(2,3)8-7-22-11-21-12(5-4-6-17)9-13-14(19)10-15(18)20-16(13)21/h9-10H,4-8,11H2,1-3H3,(H2,19,20) |
| InChIKey | QOIOXQDTZZKPLF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|