C12H24N2O2Si — CID 174096302
[4-amino-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]methanol (PubChem CID 174096302) has the molecular formula C12H24N2O2Si and a molecular weight of 256.42 g/mol. Its IUPAC name is [4-amino-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]methanol.
| Compound Name | [4-amino-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]methanol |
|---|---|
| PubChem CID | 174096302 |
| Molecular Formula | C12H24N2O2Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | [4-amino-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrrol-2-yl]methanol |
| SMILES | Cc1c(N)cc(CO)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C12H24N2O2Si/c1-10-12(13)7-11(8-15)14(10)9-16-5-6-17(2,3)4/h7,15H,5-6,8-9,13H2,1-4H3 |
| InChIKey | KFNUHOOYPPWESY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|