C10H19BrN2OSi — CID 125480758
2-[(5-bromo-2-methylimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 125480758) has the molecular formula C10H19BrN2OSi and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[(5-bromo-2-methylimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-2-methylimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 125480758 |
| Molecular Formula | C10H19BrN2OSi |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-[(5-bromo-2-methylimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ncc(Br)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C10H19BrN2OSi/c1-9-12-7-10(11)13(9)8-14-5-6-15(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | BGBZWRRQIWMVSF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|