C16H19BrF5N3OSi — CID 125498321
2-[[2-(6-bromo-3-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 125498321) has the molecular formula C16H19BrF5N3OSi and a molecular weight of 472.33 g/mol. Its IUPAC name is 2-[[2-(6-bromo-3-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(6-bromo-3-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 125498321 |
| Molecular Formula | C16H19BrF5N3OSi |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-[[2-(6-bromo-3-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(C(F)(F)C(F)(F)F)cnc1-c1ccc(Br)nc1 |
| InChI | InChI=1S/C16H19BrF5N3OSi/c1-27(2,3)7-6-26-10-25-12(15(18,19)16(20,21)22)9-24-14(25)11-4-5-13(17)23-8-11/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | YNBVPXSJASFVIE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|