C18H34BrN3O2Si — CID 162506736
(9S)-9-amino-9-[5-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]nonan-3-one (PubChem CID 162506736) has the molecular formula C18H34BrN3O2Si and a molecular weight of 432.48 g/mol. Its IUPAC name is (9S)-9-amino-9-[5-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]nonan-3-one.
| Compound Name | (9S)-9-amino-9-[5-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]nonan-3-one |
|---|---|
| PubChem CID | 162506736 |
| Molecular Formula | C18H34BrN3O2Si |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (9S)-9-amino-9-[5-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]nonan-3-one |
| SMILES | CCC(=O)CCCCC[C@H](N)c1ncc(Br)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H34BrN3O2Si/c1-5-15(23)9-7-6-8-10-16(20)18-21-13-17(19)22(18)14-24-11-12-25(2,3)4/h13,16H,5-12,14,20H2,1-4H3/t16-/m0/s1 |
| InChIKey | LCQDZYHHOZDEIN-INIZCTEOSA-N |
| XLogP | 4.89 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|