C20H38BrN3O3Si — CID 162506696
(1S)-1-[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6-(2-ethyl-1,3-dioxolan-2-yl)hexan-1-amine (PubChem CID 162506696) has the molecular formula C20H38BrN3O3Si and a molecular weight of 476.53 g/mol. Its IUPAC name is (1S)-1-[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6-(2-ethyl-1,3-dioxolan-2-yl)hexan-1-amine.
| Compound Name | (1S)-1-[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6-(2-ethyl-1,3-dioxolan-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 162506696 |
| Molecular Formula | C20H38BrN3O3Si |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (1S)-1-[4-bromo-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-6-(2-ethyl-1,3-dioxolan-2-yl)hexan-1-amine |
| SMILES | CCC1(CCCCC[C@H](N)c2nc(Br)cn2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C20H38BrN3O3Si/c1-5-20(26-11-12-27-20)10-8-6-7-9-17(22)19-23-18(21)15-24(19)16-25-13-14-28(2,3)4/h15,17H,5-14,16,22H2,1-4H3/t17-/m0/s1 |
| InChIKey | BCXVSFSUUMCSOA-KRWDZBQOSA-N |
| XLogP | 5.06 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|