C18H24BrN5OSi — CID 87327620
2-[[4-bromo-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 87327620) has the molecular formula C18H24BrN5OSi and a molecular weight of 434.41 g/mol. Its IUPAC name is 2-[[4-bromo-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-bromo-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 87327620 |
| Molecular Formula | C18H24BrN5OSi |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-[[4-bromo-2-[(E)-2-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccc2nc(/C=C/c3nc(Br)cn3COCC[Si](C)(C)C)nn12 |
| InChI | InChI=1S/C18H24BrN5OSi/c1-14-6-5-7-18-21-16(22-24(14)18)8-9-17-20-15(19)12-23(17)13-25-10-11-26(2,3)4/h5-9,12H,10-11,13H2,1-4H3/b9-8+ |
| InChIKey | YDWGDMVHXVPLFV-CMDGGOBGSA-N |
| XLogP | 4.48 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|