C22H26N2O2Si — CID 141048810
4-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde (PubChem CID 141048810) has the molecular formula C22H26N2O2Si and a molecular weight of 378.55 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde.
| Compound Name | 4-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde |
|---|---|
| PubChem CID | 141048810 |
| Molecular Formula | C22H26N2O2Si |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccc(-c3ccccc3)cc2)nc1C=O |
| InChI | InChI=1S/C22H26N2O2Si/c1-27(2,3)14-13-26-17-24-15-21(23-22(24)16-25)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-12,15-16H,13-14,17H2,1-3H3 |
| InChIKey | ZQNWEFWYJDGANS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|