C11H19NO2Si — CID 91103274
1-(2-trimethylsilylethoxymethyl)pyrrole-3-carbaldehyde (PubChem CID 91103274) has the molecular formula C11H19NO2Si and a molecular weight of 225.36 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)pyrrole-3-carbaldehyde.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 91103274 |
| Molecular Formula | C11H19NO2Si |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)pyrrole-3-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1ccc(C=O)c1 |
| InChI | InChI=1S/C11H19NO2Si/c1-15(2,3)7-6-14-10-12-5-4-11(8-12)9-13/h4-5,8-9H,6-7,10H2,1-3H3 |
| InChIKey | FDZYXYXVIXRYLC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|