C12H20N2O4Si — CID 58638526
methyl 2-formyl-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate (PubChem CID 58638526) has the molecular formula C12H20N2O4Si and a molecular weight of 284.39 g/mol. Its IUPAC name is methyl 2-formyl-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate.
| Compound Name | methyl 2-formyl-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 58638526 |
| Molecular Formula | C12H20N2O4Si |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 2-formyl-1-(2-trimethylsilylethoxymethyl)imidazole-4-carboxylate |
| SMILES | COC(=O)c1cn(COCC[Si](C)(C)C)c(C=O)n1 |
| InChI | InChI=1S/C12H20N2O4Si/c1-17-12(16)10-7-14(11(8-15)13-10)9-18-5-6-19(2,3)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | YRBSZODDDMRDMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|