C14H21IN4O3Si — CID 142755280
methyl 3-amino-7-iodo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-2-carboxylate (PubChem CID 142755280) has the molecular formula C14H21IN4O3Si and a molecular weight of 448.34 g/mol. Its IUPAC name is methyl 3-amino-7-iodo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-7-iodo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 142755280 |
| Molecular Formula | C14H21IN4O3Si |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | methyl 3-amino-7-iodo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc2c(I)cn(COCC[Si](C)(C)C)c2nc1N |
| InChI | InChI=1S/C14H21IN4O3Si/c1-21-14(20)11-12(16)18-13-10(17-11)9(15)7-19(13)8-22-5-6-23(2,3)4/h7H,5-6,8H2,1-4H3,(H2,16,18) |
| InChIKey | ORLLPDBSFKAWPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|